C15H19N3O — CID 15919005
5-benzyl-N-cyclohexyl-1,3,4-oxadiazol-2-amine (PubChem CID 15919005) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-benzyl-N-cyclohexyl-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-benzyl-N-cyclohexyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 15919005 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-benzyl-N-cyclohexyl-1,3,4-oxadiazol-2-amine |
| SMILES | c1ccc(Cc2nnc(NC3CCCCC3)o2)cc1 |
| InChI | InChI=1S/C15H19N3O/c1-3-7-12(8-4-1)11-14-17-18-15(19-14)16-13-9-5-2-6-10-13/h1,3-4,7-8,13H,2,5-6,9-11H2,(H,16,18) |
| InChIKey | JRMADLCBDDDCNV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |