About methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide
methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide (PubChem CID 159190796) has the molecular formula C27H26N4O5
and a molecular weight of 486.53 g/mol. Its IUPAC name is methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide.
Molecular Properties
| Compound Name | methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide |
| PubChem CID | 159190796 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide |
| SMILES | C.CC(=O)Nc1c(-c2ccccc2)cccc1[N+](=O)[O-].Nc1c(-c2ccccc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N2O3.C12H10N2O2.CH4/c1-10(17)15-14-12(11-6-3-2-4-7-11)8-5-9-13(14)16(18)19;13-12-10(9-5-2-1-3-6-9)7-4-8-11(12)14(15)16;/h2-9H,1H3,(H,15,17);1-8H,13H2;1H4 |
| InChIKey | KOBHTZLKOHDKDB-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 141.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide?
The IUPAC name of methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide (CID 159190796) is methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide.
What is the SMILES notation for methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide?
The canonical SMILES for methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide is C.CC(=O)Nc1c(-c2ccccc2)cccc1[N+](=O)[O-].Nc1c(-c2ccccc2)cccc1[N+](=O)[O-].
What is the InChIKey of methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide?
The InChIKey is KOBHTZLKOHDKDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3.C12H10N2O2.CH4/c1-10(17)15-14-12(11-6-3-2-4-7-11)8-5-9-13(14)16(18)19;13-12-10(9-5-2-1-3-6-9)7-4-8-11(12)14(15)16;/h2-9H,1H3,(H,15,17);1-8H,13H2;1H4.
What are the key properties of methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide?
methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide has a molecular weight of 486.53 g/mol, XLogP of 6.70, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-nitro-6-phenylaniline;N-(2-nitro-6-phenylphenyl)acetamide is sourced from PubChem (CID 159190796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).