C24H40O8 — CID 159194650
ethyl (2R)-2-[2-[(4S,5R)-5-[(4S,5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]octanoate (PubChem CID 159194650) has the molecular formula C24H40O8 and a molecular weight of 456.58 g/mol. Its IUPAC name is ethyl (2R)-2-[2-[(4S,5R)-5-[(4S,5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]octanoate.
| Compound Name | ethyl (2R)-2-[2-[(4S,5R)-5-[(4S,5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]octanoate |
|---|---|
| PubChem CID | 159194650 |
| Molecular Formula | C24H40O8 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | ethyl (2R)-2-[2-[(4S,5R)-5-[(4S,5R)-5-acetyl-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethyl]octanoate |
| SMILES | CCCCCC[C@H](CC(=O)[C@H]1OC(C)(C)O[C@@H]1[C@@H]1OC(C)(C)O[C@H]1C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C24H40O8/c1-8-10-11-12-13-16(22(27)28-9-2)14-17(26)19-21(32-24(6,7)30-19)20-18(15(3)25)29-23(4,5)31-20/h16,18-21H,8-14H2,1-7H3/t16-,18+,19-,20-,21+/m1/s1 |
| InChIKey | YQWYRMSLDGAFHA-PPQDBTBKSA-N |
| XLogP | 3.72 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|