C25H25BrF2N4O3S — CID 159196077
ethyl 6-amino-2-[3-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-3,3-difluoro-2-oxopropyl]hexanoate (PubChem CID 159196077) has the molecular formula C25H25BrF2N4O3S and a molecular weight of 579.47 g/mol. Its IUPAC name is ethyl 6-amino-2-[3-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-3,3-difluoro-2-oxopropyl]hexanoate.
| Compound Name | ethyl 6-amino-2-[3-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-3,3-difluoro-2-oxopropyl]hexanoate |
|---|---|
| PubChem CID | 159196077 |
| Molecular Formula | C25H25BrF2N4O3S |
| Molecular Weight | 579.47 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | ethyl 6-amino-2-[3-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-3,3-difluoro-2-oxopropyl]hexanoate |
| SMILES | CCOC(=O)C(CCCCN)CC(=O)C(F)(F)Sc1ncc(Br)n1-c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C25H25BrF2N4O3S/c1-2-35-23(34)16(7-5-6-12-29)13-21(33)25(27,28)36-24-31-15-22(26)32(24)20-11-10-17(14-30)18-8-3-4-9-19(18)20/h3-4,8-11,15-16H,2,5-7,12-13,29H2,1H3 |
| InChIKey | KORHJECGWANJCT-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|