C18H12BrF2N4O2S+ — CID 91494453
[2-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-2,2-difluoroacetyl]oxy-methyl-methylideneazanium (PubChem CID 91494453) has the molecular formula C18H12BrF2N4O2S+ and a molecular weight of 466.29 g/mol. Its IUPAC name is [2-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-2,2-difluoroacetyl]oxy-methyl-methylideneazanium.
| Compound Name | [2-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-2,2-difluoroacetyl]oxy-methyl-methylideneazanium |
|---|---|
| PubChem CID | 91494453 |
| Molecular Formula | C18H12BrF2N4O2S+ |
| Molecular Weight | 466.29 g/mol |
| Exact Mass | 464.98 |
| IUPAC Name | [2-[5-bromo-1-(4-cyanonaphthalen-1-yl)imidazol-2-yl]sulfanyl-2,2-difluoroacetyl]oxy-methyl-methylideneazanium |
| SMILES | C=[N+](C)OC(=O)C(F)(F)Sc1ncc(Br)n1-c1ccc(C#N)c2ccccc12 |
| InChI | InChI=1S/C18H12BrF2N4O2S/c1-24(2)27-16(26)18(20,21)28-17-23-10-15(19)25(17)14-8-7-11(9-22)12-5-3-4-6-13(12)14/h3-8,10H,1H2,2H3/q+1 |
| InChIKey | OUUCNDDHMONJLO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|