C26H31F6N7O2 — CID 159196593
1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide;N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 159196593) has the molecular formula C26H31F6N7O2 and a molecular weight of 587.57 g/mol. Its IUPAC name is 1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide;N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | 1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide;N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 159196593 |
| Molecular Formula | C26H31F6N7O2 |
| Molecular Weight | 587.57 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 1-(6H-pyrrolo[3,2-f][1,7]naphthyridin-9-yl)-N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide;N-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | O=C(NCC(F)(F)F)C1CCCN(c2cc[nH]c3cnc4nccc4c23)C1.O=C(NCC(F)(F)F)C1CCCNC1 |
| InChI | InChI=1S/C18H18F3N5O.C8H13F3N2O/c19-18(20,21)10-25-17(27)11-2-1-7-26(9-11)14-4-6-22-13-8-24-16-12(15(13)14)3-5-23-16;9-8(10,11)5-13-7(14)6-2-1-3-12-4-6/h3-6,8,11,22H,1-2,7,9-10H2,(H,25,27);6,12H,1-5H2,(H,13,14) |
| InChIKey | XEKSZPYJKHIKML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |