C26H32Cl6O10 — CID 159196991
oxalic acid;bis(3,4,6-trichloro-6-pentoxycyclohexa-2,4-diene-1-carboxylic acid) (PubChem CID 159196991) has the molecular formula C26H32Cl6O10 and a molecular weight of 717.25 g/mol. Its IUPAC name is oxalic acid;bis(3,4,6-trichloro-6-pentoxycyclohexa-2,4-diene-1-carboxylic acid).
| Compound Name | oxalic acid;bis(3,4,6-trichloro-6-pentoxycyclohexa-2,4-diene-1-carboxylic acid) |
|---|---|
| PubChem CID | 159196991 |
| Molecular Formula | C26H32Cl6O10 |
| Molecular Weight | 717.25 g/mol |
| Exact Mass | 714.01 |
| IUPAC Name | oxalic acid;bis(3,4,6-trichloro-6-pentoxycyclohexa-2,4-diene-1-carboxylic acid) |
| SMILES | CCCCCOC1(Cl)C=C(Cl)C(Cl)=CC1C(=O)O.CCCCCOC1(Cl)C=C(Cl)C(Cl)=CC1C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/2C12H15Cl3O3.C2H2O4/c2*1-2-3-4-5-18-12(15)7-10(14)9(13)6-8(12)11(16)17;3-1(4)2(5)6/h2*6-8H,2-5H2,1H3,(H,16,17);(H,3,4)(H,5,6) |
| InChIKey | MQSGDXYLJHUFML-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.25 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|