C14H16O4 — CID 71345396
2-hydroxy-2-pentoxyindene-1,3-dione (PubChem CID 71345396) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-hydroxy-2-pentoxyindene-1,3-dione.
| Compound Name | 2-hydroxy-2-pentoxyindene-1,3-dione |
|---|---|
| PubChem CID | 71345396 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-hydroxy-2-pentoxyindene-1,3-dione |
| SMILES | CCCCCOC1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C14H16O4/c1-2-3-6-9-18-14(17)12(15)10-7-4-5-8-11(10)13(14)16/h4-5,7-8,17H,2-3,6,9H2,1H3 |
| InChIKey | DJTPTMYLHKNSFN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|