C23H27NO4 — CID 139654151
2-[2-butoxy-4-(diethylamino)phenyl]-2-hydroxyindene-1,3-dione (PubChem CID 139654151) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is 2-[2-butoxy-4-(diethylamino)phenyl]-2-hydroxyindene-1,3-dione.
| Compound Name | 2-[2-butoxy-4-(diethylamino)phenyl]-2-hydroxyindene-1,3-dione |
|---|---|
| PubChem CID | 139654151 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-[2-butoxy-4-(diethylamino)phenyl]-2-hydroxyindene-1,3-dione |
| SMILES | CCCCOc1cc(N(CC)CC)ccc1C1(O)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H27NO4/c1-4-7-14-28-20-15-16(24(5-2)6-3)12-13-19(20)23(27)21(25)17-10-8-9-11-18(17)22(23)26/h8-13,15,27H,4-7,14H2,1-3H3 |
| InChIKey | MJBZNTAAELWRNE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|