C50H68O6 — CID 10795236
(9R,10S)-9,10-bis(3,4-dihexoxyphenyl)phenanthrene-9,10-diol (PubChem CID 10795236) has the molecular formula C50H68O6 and a molecular weight of 765.09 g/mol. Its IUPAC name is (9R,10S)-9,10-bis(3,4-dihexoxyphenyl)phenanthrene-9,10-diol.
| Compound Name | (9R,10S)-9,10-bis(3,4-dihexoxyphenyl)phenanthrene-9,10-diol |
|---|---|
| PubChem CID | 10795236 |
| Molecular Formula | C50H68O6 |
| Molecular Weight | 765.09 g/mol |
| Exact Mass | 764.50 |
| IUPAC Name | (9R,10S)-9,10-bis(3,4-dihexoxyphenyl)phenanthrene-9,10-diol |
| SMILES | CCCCCCOc1ccc([C@@]2(O)c3ccccc3-c3ccccc3[C@@]2(O)c2ccc(OCCCCCC)c(OCCCCCC)c2)cc1OCCCCCC |
| InChI | InChI=1S/C50H68O6/c1-5-9-13-21-33-53-45-31-29-39(37-47(45)55-35-23-15-11-7-3)49(51)43-27-19-17-25-41(43)42-26-18-20-28-44(42)50(49,52)40-30-32-46(54-34-22-14-10-6-2)48(38-40)56-36-24-16-12-8-4/h17-20,25-32,37-38,51-52H,5-16,21-24,33-36H2,1-4H3/t49-,50+ |
| InChIKey | MUEUZNPAMOQUIX-DKSDCYBHSA-N |
| XLogP | 12.68 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.09 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|