C51H50Br2N2O4 — CID 4959999
3-bromo-N-[4-[9-[4-[(3-bromo-4-hexoxybenzoyl)amino]phenyl]fluoren-9-yl]phenyl]-4-hexoxybenzamide (PubChem CID 4959999) has the molecular formula C51H50Br2N2O4 and a molecular weight of 914.78 g/mol. Its IUPAC name is 3-bromo-N-[4-[9-[4-[(3-bromo-4-hexoxybenzoyl)amino]phenyl]fluoren-9-yl]phenyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[4-[9-[4-[(3-bromo-4-hexoxybenzoyl)amino]phenyl]fluoren-9-yl]phenyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 4959999 |
| Molecular Formula | C51H50Br2N2O4 |
| Molecular Weight | 914.78 g/mol |
| Exact Mass | 912.21 |
| IUPAC Name | 3-bromo-N-[4-[9-[4-[(3-bromo-4-hexoxybenzoyl)amino]phenyl]fluoren-9-yl]phenyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccc(C3(c4ccc(NC(=O)c5ccc(OCCCCCC)c(Br)c5)cc4)c4ccccc4-c4ccccc43)cc2)cc1Br |
| InChI | InChI=1S/C51H50Br2N2O4/c1-3-5-7-13-31-58-47-29-19-35(33-45(47)52)49(56)54-39-25-21-37(22-26-39)51(43-17-11-9-15-41(43)42-16-10-12-18-44(42)51)38-23-27-40(28-24-38)55-50(57)36-20-30-48(46(53)34-36)59-32-14-8-6-4-2/h9-12,15-30,33-34H,3-8,13-14,31-32H2,1-2H3,(H,54,56)(H,55,57) |
| InChIKey | QSTYLTGASDMJRH-UHFFFAOYSA-N |
| XLogP | 14.00 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 914.78 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|