About 2-octylbutanediperoxoic acid
2-octylbutanediperoxoic acid (PubChem CID 15919706) has the molecular formula C12H22O6
and a molecular weight of 262.30 g/mol. Its IUPAC name is 2-octylbutanediperoxoic acid.
Molecular Properties
| Compound Name | 2-octylbutanediperoxoic acid |
| PubChem CID | 15919706 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-octylbutanediperoxoic acid |
| SMILES | CCCCCCCCC(CC(=O)OO)C(=O)OO |
| InChI | InChI=1S/C12H22O6/c1-2-3-4-5-6-7-8-10(12(14)18-16)9-11(13)17-15/h10,15-16H,2-9H2,1H3 |
| InChIKey | XMSFZHWBBUOKRY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-octylbutanediperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octylbutanediperoxoic acid?
The IUPAC name of 2-octylbutanediperoxoic acid (CID 15919706) is 2-octylbutanediperoxoic acid.
What is the SMILES notation for 2-octylbutanediperoxoic acid?
The canonical SMILES for 2-octylbutanediperoxoic acid is CCCCCCCCC(CC(=O)OO)C(=O)OO.
What is the InChIKey of 2-octylbutanediperoxoic acid?
The InChIKey is XMSFZHWBBUOKRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O6/c1-2-3-4-5-6-7-8-10(12(14)18-16)9-11(13)17-15/h10,15-16H,2-9H2,1H3.
What are the key properties of 2-octylbutanediperoxoic acid?
2-octylbutanediperoxoic acid has a molecular weight of 262.30 g/mol, XLogP of 2.78, 10 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octylbutanediperoxoic acid is sourced from PubChem (CID 15919706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).