C33H49BrN2O2 — CID 159200419
(2S)-2-amino-4-methylpentan-1-ol;bromomethylbenzene;(2R)-2-(dibenzylamino)-4-methylpentan-1-ol (PubChem CID 159200419) has the molecular formula C33H49BrN2O2 and a molecular weight of 585.67 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentan-1-ol;bromomethylbenzene;(2R)-2-(dibenzylamino)-4-methylpentan-1-ol.
| Compound Name | (2S)-2-amino-4-methylpentan-1-ol;bromomethylbenzene;(2R)-2-(dibenzylamino)-4-methylpentan-1-ol |
|---|---|
| PubChem CID | 159200419 |
| Molecular Formula | C33H49BrN2O2 |
| Molecular Weight | 585.67 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | (2S)-2-amino-4-methylpentan-1-ol;bromomethylbenzene;(2R)-2-(dibenzylamino)-4-methylpentan-1-ol |
| SMILES | BrCc1ccccc1.CC(C)C[C@H](CO)N(Cc1ccccc1)Cc1ccccc1.CC(C)C[C@H](N)CO |
| InChI | InChI=1S/C20H27NO.C7H7Br.C6H15NO/c1-17(2)13-20(16-22)21(14-18-9-5-3-6-10-18)15-19-11-7-4-8-12-19;8-6-7-4-2-1-3-5-7;1-5(2)3-6(7)4-8/h3-12,17,20,22H,13-16H2,1-2H3;1-5H,6H2;5-6,8H,3-4,7H2,1-2H3/t20-;;6-/m1.0/s1 |
| InChIKey | KPFCYFFFHKHJLH-JAQYHBMOSA-N |
| XLogP | 7.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.67 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|