C34H72N6 — CID 159200626
2,3,4,5-tetramethylhexa-2,4-diene;bis(N,N,3-trimethylbut-2-en-2-amine);bis(N,N,N'-trimethylethanimidamide) (PubChem CID 159200626) has the molecular formula C34H72N6 and a molecular weight of 564.99 g/mol. Its IUPAC name is 2,3,4,5-tetramethylhexa-2,4-diene;bis(N,N,3-trimethylbut-2-en-2-amine);bis(N,N,N'-trimethylethanimidamide).
| Compound Name | 2,3,4,5-tetramethylhexa-2,4-diene;bis(N,N,3-trimethylbut-2-en-2-amine);bis(N,N,N'-trimethylethanimidamide) |
|---|---|
| PubChem CID | 159200626 |
| Molecular Formula | C34H72N6 |
| Molecular Weight | 564.99 g/mol |
| Exact Mass | 564.58 |
| IUPAC Name | 2,3,4,5-tetramethylhexa-2,4-diene;bis(N,N,3-trimethylbut-2-en-2-amine);bis(N,N,N'-trimethylethanimidamide) |
| SMILES | C/N=C(\C)N(C)C.C/N=C(\C)N(C)C.CC(C)=C(C)C(C)=C(C)C.CC(C)=C(C)N(C)C.CC(C)=C(C)N(C)C |
| InChI | InChI=1S/C10H18.2C7H15N.2C5H12N2/c1-7(2)9(5)10(6)8(3)4;2*1-6(2)7(3)8(4)5;2*1-5(6-2)7(3)4/h1-6H3;2*1-5H3;2*1-4H3/b;;;2*6-5+ |
| InChIKey | KPFWGASYQRSQEV-RFWKPZRTSA-N |
| XLogP | 8.61 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.99 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|