C36H52N12O4 — CID 159202372
3-(cyclopropanecarbonylamino)-1-[4-(ethylamino)-1-(isocyanomethyl)cyclohexyl]pyrazole-4-carboxamide (PubChem CID 159202372) has the molecular formula C36H52N12O4 and a molecular weight of 716.89 g/mol. Its IUPAC name is 3-(cyclopropanecarbonylamino)-1-[4-(ethylamino)-1-(isocyanomethyl)cyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-(cyclopropanecarbonylamino)-1-[4-(ethylamino)-1-(isocyanomethyl)cyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 159202372 |
| Molecular Formula | C36H52N12O4 |
| Molecular Weight | 716.89 g/mol |
| Exact Mass | 716.42 |
| IUPAC Name | 3-(cyclopropanecarbonylamino)-1-[4-(ethylamino)-1-(isocyanomethyl)cyclohexyl]pyrazole-4-carboxamide |
| SMILES | [C-]#[N+]CC1(n2cc(C(N)=O)c(NC(=O)C3CC3)n2)CCC(NCC)CC1.[C-]#[N+]CC1(n2cc(C(N)=O)c(NC(=O)C3CC3)n2)CCC(NCC)CC1 |
| InChI | InChI=1S/2C18H26N6O2/c2*1-3-21-13-6-8-18(9-7-13,11-20-2)24-10-14(15(19)25)16(23-24)22-17(26)12-4-5-12/h2*10,12-13,21H,3-9,11H2,1H3,(H2,19,25)(H,22,23,26) |
| InChIKey | KPLJYDWUKGSOJH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 212.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|