C35H65N3O12 — CID 159203067
1-azido-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethane;2-[2-(2-ethoxyethoxy)ethoxymethyl]-1,3,5-trimethylbenzene (PubChem CID 159203067) has the molecular formula C35H65N3O12 and a molecular weight of 719.91 g/mol. Its IUPAC name is 1-azido-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethane;2-[2-(2-ethoxyethoxy)ethoxymethyl]-1,3,5-trimethylbenzene.
| Compound Name | 1-azido-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethane;2-[2-(2-ethoxyethoxy)ethoxymethyl]-1,3,5-trimethylbenzene |
|---|---|
| PubChem CID | 159203067 |
| Molecular Formula | C35H65N3O12 |
| Molecular Weight | 719.91 g/mol |
| Exact Mass | 719.46 |
| IUPAC Name | 1-azido-2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethane;2-[2-(2-ethoxyethoxy)ethoxymethyl]-1,3,5-trimethylbenzene |
| SMILES | CCOCCOCCOCc1c(C)cc(C)cc1C.COCCOCCOCCOCCOCCOCCOCCOCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C19H39N3O9.C16H26O3/c1-23-4-5-25-8-9-27-12-13-29-16-17-31-19-18-30-15-14-28-11-10-26-7-6-24-3-2-21-22-20;1-5-17-6-7-18-8-9-19-12-16-14(3)10-13(2)11-15(16)4/h2-19H2,1H3;10-11H,5-9,12H2,1-4H3 |
| InChIKey | KPNMUMWXYRQMTA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 159.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.91 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|