About [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride
[4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride (PubChem CID 159204182) has the molecular formula C15H29BFOSi-
and a molecular weight of 283.29 g/mol. Its IUPAC name is [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride.
Molecular Properties
| Compound Name | [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride |
| PubChem CID | 159204182 |
| Molecular Formula | C15H29BFOSi- |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride |
| SMILES | F.[BH3-]c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C15H28BOSi.FH/c1-11(2)18(12(3)4,13(5)6)17-15-9-7-14(16)8-10-15;/h7-13H,1-6,16H3;1H/q-1; |
| InChIKey | KPQXGSAOZURLMC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride?
The IUPAC name of [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride (CID 159204182) is [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride.
What is the SMILES notation for [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride?
The canonical SMILES for [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride is F.[BH3-]c1ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc1.
What is the InChIKey of [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride?
The InChIKey is KPQXGSAOZURLMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28BOSi.FH/c1-11(2)18(12(3)4,13(5)6)17-15-9-7-14(16)8-10-15;/h7-13H,1-6,16H3;1H/q-1;.
What are the key properties of [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride?
[4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride has a molecular weight of 283.29 g/mol, XLogP of 3.38, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-tri(propan-2-yl)silyloxyphenyl]boranuide;hydrofluoride is sourced from PubChem (CID 159204182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).