C22H23N3O — CID 159207035
2,7-diphenylpyrido[3,2-d]pyrimidine;ethane;methanol (PubChem CID 159207035) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is 2,7-diphenylpyrido[3,2-d]pyrimidine;ethane;methanol.
| Compound Name | 2,7-diphenylpyrido[3,2-d]pyrimidine;ethane;methanol |
|---|---|
| PubChem CID | 159207035 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | 2,7-diphenylpyrido[3,2-d]pyrimidine;ethane;methanol |
| SMILES | CC.CO.c1ccc(-c2cnc3cnc(-c4ccccc4)nc3c2)cc1 |
| InChI | InChI=1S/C19H13N3.C2H6.CH4O/c1-3-7-14(8-4-1)16-11-17-18(20-12-16)13-21-19(22-17)15-9-5-2-6-10-15;2*1-2/h1-13H;1-2H3;2H,1H3 |
| InChIKey | KPZZCLUYIAVVAM-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |