C42H52O9 — CID 159208849
bis(ethyl (E)-3-hydroxy-6-phenylhex-4-enoate);ethyl (E)-3-oxo-6-phenylhex-4-enoate (PubChem CID 159208849) has the molecular formula C42H52O9 and a molecular weight of 700.87 g/mol. Its IUPAC name is bis(ethyl (E)-3-hydroxy-6-phenylhex-4-enoate);ethyl (E)-3-oxo-6-phenylhex-4-enoate.
| Compound Name | bis(ethyl (E)-3-hydroxy-6-phenylhex-4-enoate);ethyl (E)-3-oxo-6-phenylhex-4-enoate |
|---|---|
| PubChem CID | 159208849 |
| Molecular Formula | C42H52O9 |
| Molecular Weight | 700.87 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | bis(ethyl (E)-3-hydroxy-6-phenylhex-4-enoate);ethyl (E)-3-oxo-6-phenylhex-4-enoate |
| SMILES | CCOC(=O)CC(=O)/C=C/Cc1ccccc1.CCOC(=O)CC(O)/C=C/Cc1ccccc1.CCOC(=O)CC(O)/C=C/Cc1ccccc1 |
| InChI | InChI=1S/2C14H18O3.C14H16O3/c3*1-2-17-14(16)11-13(15)10-6-9-12-7-4-3-5-8-12/h2*3-8,10,13,15H,2,9,11H2,1H3;3-8,10H,2,9,11H2,1H3/b3*10-6+ |
| InChIKey | KQFRAMOMUNAUBQ-SMEZBRHWSA-N |
| XLogP | 6.51 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|