C61H46 — CID 159210224
11a,12-dihydroindeno[1,2-c]fluorene;6,12-dihydroindeno[1,2-b]fluorene;10,12-dihydroindeno[2,1-b]fluorene;methane (PubChem CID 159210224) has the molecular formula C61H46 and a molecular weight of 779.04 g/mol. Its IUPAC name is 11a,12-dihydroindeno[1,2-c]fluorene;6,12-dihydroindeno[1,2-b]fluorene;10,12-dihydroindeno[2,1-b]fluorene;methane.
| Compound Name | 11a,12-dihydroindeno[1,2-c]fluorene;6,12-dihydroindeno[1,2-b]fluorene;10,12-dihydroindeno[2,1-b]fluorene;methane |
|---|---|
| PubChem CID | 159210224 |
| Molecular Formula | C61H46 |
| Molecular Weight | 779.04 g/mol |
| Exact Mass | 778.36 |
| IUPAC Name | 11a,12-dihydroindeno[1,2-c]fluorene;6,12-dihydroindeno[1,2-b]fluorene;10,12-dihydroindeno[2,1-b]fluorene;methane |
| SMILES | C.C1=CC2=Cc3ccc4c(c3C2C=C1)Cc1ccccc1-4.c1ccc2c(c1)Cc1cc3c(cc1-2)-c1ccccc1C3.c1ccc2c(c1)Cc1cc3c(cc1-2)Cc1ccccc1-3 |
| InChI | InChI=1S/3C20H14.CH4/c1-3-7-16-14(6-1)12-19-18(16)10-9-15-11-13-5-2-4-8-17(13)20(15)19;1-3-7-17-13(5-1)9-15-11-20-16(12-19(15)17)10-14-6-2-4-8-18(14)20;1-3-7-17-13(5-1)9-15-11-16-10-14-6-2-4-8-18(14)20(16)12-19(15)17;/h1-11,17H,12H2;2*1-8,11-12H,9-10H2;1H4 |
| InChIKey | KQKCCOVDGFIYDR-UHFFFAOYSA-N |
| XLogP | 15.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.04 |
| LogP ≤ 5 | 15.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |