C24H31N7 — CID 159213950
(E)-3-cyclohexyl-1-(5-methyl-1H-pyrazol-4-yl)-N-(6-piperazin-1-yl-1H-indazol-5-yl)prop-2-en-1-imine (PubChem CID 159213950) has the molecular formula C24H31N7 and a molecular weight of 417.56 g/mol. Its IUPAC name is (E)-3-cyclohexyl-1-(5-methyl-1H-pyrazol-4-yl)-N-(6-piperazin-1-yl-1H-indazol-5-yl)prop-2-en-1-imine.
| Compound Name | (E)-3-cyclohexyl-1-(5-methyl-1H-pyrazol-4-yl)-N-(6-piperazin-1-yl-1H-indazol-5-yl)prop-2-en-1-imine |
|---|---|
| PubChem CID | 159213950 |
| Molecular Formula | C24H31N7 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (E)-3-cyclohexyl-1-(5-methyl-1H-pyrazol-4-yl)-N-(6-piperazin-1-yl-1H-indazol-5-yl)prop-2-en-1-imine |
| SMILES | Cc1[nH]ncc1C(/C=C/C1CCCCC1)=N/c1cc2cn[nH]c2cc1N1CCNCC1 |
| InChI | InChI=1S/C24H31N7/c1-17-20(16-27-29-17)21(8-7-18-5-3-2-4-6-18)28-23-13-19-15-26-30-22(19)14-24(23)31-11-9-25-10-12-31/h7-8,13-16,18,25H,2-6,9-12H2,1H3,(H,26,30)(H,27,29)/b8-7+,28-21+ |
| InChIKey | HTZYVSXJFXCBSO-DBNLXQKQSA-N |
| XLogP | 4.26 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|