C21H22O2 — CID 159220371
3-methoxy-1-(2,3,4,6-tetramethylphenyl)naphthalen-2-ol (PubChem CID 159220371) has the molecular formula C21H22O2 and a molecular weight of 306.40 g/mol. Its IUPAC name is 3-methoxy-1-(2,3,4,6-tetramethylphenyl)naphthalen-2-ol.
| Compound Name | 3-methoxy-1-(2,3,4,6-tetramethylphenyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 159220371 |
| Molecular Formula | C21H22O2 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-methoxy-1-(2,3,4,6-tetramethylphenyl)naphthalen-2-ol |
| SMILES | COc1cc2ccccc2c(-c2c(C)cc(C)c(C)c2C)c1O |
| InChI | InChI=1S/C21H22O2/c1-12-10-13(2)19(15(4)14(12)3)20-17-9-7-6-8-16(17)11-18(23-5)21(20)22/h6-11,22H,1-5H3 |
| InChIKey | MGVBJWBTUBWLRW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |