C20H21NO2 — CID 158265528
1-(6-amino-2,3,4-trimethylphenyl)-3-methoxynaphthalen-2-ol (PubChem CID 158265528) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 1-(6-amino-2,3,4-trimethylphenyl)-3-methoxynaphthalen-2-ol.
| Compound Name | 1-(6-amino-2,3,4-trimethylphenyl)-3-methoxynaphthalen-2-ol |
|---|---|
| PubChem CID | 158265528 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 1-(6-amino-2,3,4-trimethylphenyl)-3-methoxynaphthalen-2-ol |
| SMILES | COc1cc2ccccc2c(-c2c(N)cc(C)c(C)c2C)c1O |
| InChI | InChI=1S/C20H21NO2/c1-11-9-16(21)18(13(3)12(11)2)19-15-8-6-5-7-14(15)10-17(23-4)20(19)22/h5-10,22H,21H2,1-4H3 |
| InChIKey | IXVQEZPBIAMCFR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|