C24H28O4 — CID 159221128
methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-5-formyl-2-methylphenyl]prop-2-enoate (PubChem CID 159221128) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-5-formyl-2-methylphenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-5-formyl-2-methylphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 159221128 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | methyl (E)-3-[4-[2-adamantylidene(methoxy)methyl]-5-formyl-2-methylphenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(C=O)c(C(OC)=C2C3CC4CC(C3)CC2C4)cc1C |
| InChI | InChI=1S/C24H28O4/c1-14-6-21(20(13-25)12-17(14)4-5-22(26)27-2)24(28-3)23-18-8-15-7-16(10-18)11-19(23)9-15/h4-6,12-13,15-16,18-19H,7-11H2,1-3H3/b5-4+,24-23- |
| InChIKey | IQLWRIPEZSOWIO-INLHLZPNSA-N |
| XLogP | 4.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|