C22H26O3 — CID 158264300
(E)-4-[4-[2-adamantylidene(methoxy)methyl]-2-hydroxyphenyl]but-3-en-2-one (PubChem CID 158264300) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (E)-4-[4-[2-adamantylidene(methoxy)methyl]-2-hydroxyphenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[2-adamantylidene(methoxy)methyl]-2-hydroxyphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158264300 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (E)-4-[4-[2-adamantylidene(methoxy)methyl]-2-hydroxyphenyl]but-3-en-2-one |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1ccc(/C=C/C(C)=O)c(O)c1 |
| InChI | InChI=1S/C22H26O3/c1-13(23)3-4-16-5-6-17(12-20(16)24)22(25-2)21-18-8-14-7-15(10-18)11-19(21)9-14/h3-6,12,14-15,18-19,24H,7-11H2,1-2H3/b4-3+,22-21- |
| InChIKey | UGNADOSKXOUUBA-YZMYVKQFSA-N |
| XLogP | 4.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|