C21H24ClO7P — CID 130296573
(E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-phosphonooxyphenyl]prop-2-enoic acid (PubChem CID 130296573) has the molecular formula C21H24ClO7P and a molecular weight of 454.84 g/mol. Its IUPAC name is (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-phosphonooxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-phosphonooxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130296573 |
| Molecular Formula | C21H24ClO7P |
| Molecular Weight | 454.84 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | (E)-3-[4-[2-adamantylidene(methoxy)methyl]-3-chloro-2-phosphonooxyphenyl]prop-2-enoic acid |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1ccc(/C=C/C(=O)O)c(OP(=O)(O)O)c1Cl |
| InChI | InChI=1S/C21H24ClO7P/c1-28-21(18-14-7-11-6-12(9-14)10-15(18)8-11)16-4-2-13(3-5-17(23)24)20(19(16)22)29-30(25,26)27/h2-5,11-12,14-15H,6-10H2,1H3,(H,23,24)(H2,25,26,27)/b5-3+,21-18- |
| InChIKey | LLNRIORJRFIATD-RXTOKUOUSA-N |
| XLogP | 4.72 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|