C34H37ClO11 — CID 176977167
(3S,6S)-6-[4-[[3-[2-adamantylidene(methoxy)methyl]-6-[(E)-2-carboxyethenyl]-2-chlorophenoxy]methyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 176977167) has the molecular formula C34H37ClO11 and a molecular weight of 657.11 g/mol. Its IUPAC name is (3S,6S)-6-[4-[[3-[2-adamantylidene(methoxy)methyl]-6-[(E)-2-carboxyethenyl]-2-chlorophenoxy]methyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | (3S,6S)-6-[4-[[3-[2-adamantylidene(methoxy)methyl]-6-[(E)-2-carboxyethenyl]-2-chlorophenoxy]methyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 176977167 |
| Molecular Formula | C34H37ClO11 |
| Molecular Weight | 657.11 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | (3S,6S)-6-[4-[[3-[2-adamantylidene(methoxy)methyl]-6-[(E)-2-carboxyethenyl]-2-chlorophenoxy]methyl]phenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1ccc(/C=C/C(=O)O)c(OCc2ccc(O[C@@H]3OC(C(=O)O)[C@@H](O)C(O)C3O)cc2)c1Cl |
| InChI | InChI=1S/C34H37ClO11/c1-43-31(25-20-11-17-10-18(13-20)14-21(25)12-17)23-8-4-19(5-9-24(36)37)30(26(23)35)44-15-16-2-6-22(7-3-16)45-34-29(40)27(38)28(39)32(46-34)33(41)42/h2-9,17-18,20-21,27-29,32,34,38-40H,10-15H2,1H3,(H,36,37)(H,41,42)/b9-5+,31-25-/t17?,18?,20?,21?,27?,28-,29?,32?,34+/m0/s1 |
| InChIKey | OJUPCLNIEKPYFQ-WAZXSMPYSA-N |
| XLogP | 4.10 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.11 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|