C34H39NO8 — CID 147795138
(E)-3-[4-[2-adamantylidene(methoxy)methyl]-2-[[4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enenitrile (PubChem CID 147795138) has the molecular formula C34H39NO8 and a molecular weight of 589.69 g/mol. Its IUPAC name is (E)-3-[4-[2-adamantylidene(methoxy)methyl]-2-[[4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[2-adamantylidene(methoxy)methyl]-2-[[4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 147795138 |
| Molecular Formula | C34H39NO8 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | (E)-3-[4-[2-adamantylidene(methoxy)methyl]-2-[[4-[(2S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enenitrile |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1ccc(/C=C/C#N)c(OCc2ccc(O[C@@H]3OC(CO)[C@H](O)C(O)C3O)cc2)c1 |
| InChI | InChI=1S/C34H39NO8/c1-40-33(29-24-12-20-11-21(14-24)15-25(29)13-20)23-7-6-22(3-2-10-35)27(16-23)41-18-19-4-8-26(9-5-19)42-34-32(39)31(38)30(37)28(17-36)43-34/h2-9,16,20-21,24-25,28,30-32,34,36-39H,11-15,17-18H2,1H3/b3-2+,33-29-/t20?,21?,24?,25?,28?,30-,31?,32?,34+/m0/s1 |
| InChIKey | HKKJELSAGWOADY-NSPXEAKVSA-N |
| XLogP | 3.79 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|