C24H32O7 — CID 14836161
2-[3-[2-adamantylidene(methoxy)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 14836161) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-[3-[2-adamantylidene(methoxy)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[3-[2-adamantylidene(methoxy)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 14836161 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | 2-[3-[2-adamantylidene(methoxy)methyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1cccc(OC2OC(CO)C(O)C(O)C2O)c1 |
| InChI | InChI=1S/C24H32O7/c1-29-23(19-15-6-12-5-13(8-15)9-16(19)7-12)14-3-2-4-17(10-14)30-24-22(28)21(27)20(26)18(11-25)31-24/h2-4,10,12-13,15-16,18,20-22,24-28H,5-9,11H2,1H3/b23-19- |
| InChIKey | AMOCYWHOWMYMQQ-NMWGTECJSA-N |
| XLogP | 1.68 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|