C24H32O9 — CID 59616571
(3S,5S,6S)-2-(hydroxymethyl)-6-[3-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]oxane-3,4,5-triol (PubChem CID 59616571) has the molecular formula C24H32O9 and a molecular weight of 467.53 g/mol. Its IUPAC name is (3S,5S,6S)-2-(hydroxymethyl)-6-[3-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]oxane-3,4,5-triol.
| Compound Name | (3S,5S,6S)-2-(hydroxymethyl)-6-[3-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59616571 |
| Molecular Formula | C24H32O9 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (3S,5S,6S)-2-(hydroxymethyl)-6-[3-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]oxane-3,4,5-triol |
| SMILES | [2H]C([2H])([2H])OC1(c2cccc(O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C24H32O9/c1-29-24(23(32-33-24)15-6-12-5-13(8-15)9-16(23)7-12)14-3-2-4-17(10-14)30-22-21(28)20(27)19(26)18(11-25)31-22/h2-4,10,12-13,15-16,18-22,25-28H,5-9,11H2,1H3/t12?,13?,15?,16?,18?,19-,20?,21+,22-,23?,24?/m1/s1/i1D3 |
| InChIKey | CIZHYMVIFTYLLD-JDDHYIGXSA-N |
| XLogP | 0.82 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|