C26H35ClO9 — CID 89182747
2-[5-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)-2-ethylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89182747) has the molecular formula C26H35ClO9 and a molecular weight of 527.01 g/mol. Its IUPAC name is 2-[5-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)-2-ethylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[5-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)-2-ethylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89182747 |
| Molecular Formula | C26H35ClO9 |
| Molecular Weight | 527.01 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 2-[5-(1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl)-2-ethylphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(C2(OC)OOC23C2CC4CC3CC(Cl)(C4)C2)cc1OC1OC(CO)C(O)C(O)C1O |
| InChI | InChI=1S/C26H35ClO9/c1-3-14-4-5-15(8-18(14)33-23-22(31)21(30)20(29)19(12-28)34-23)26(32-2)25(35-36-26)16-6-13-7-17(25)11-24(27,9-13)10-16/h4-5,8,13,16-17,19-23,28-31H,3,6-7,9-12H2,1-2H3 |
| InChIKey | JHWXKUGEUOCWHY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.01 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|