C24H31ClO9 — CID 59429144
(2S,4S,5S)-2-[2-chloro-5-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59429144) has the molecular formula C24H31ClO9 and a molecular weight of 501.97 g/mol. Its IUPAC name is (2S,4S,5S)-2-[2-chloro-5-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,4S,5S)-2-[2-chloro-5-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59429144 |
| Molecular Formula | C24H31ClO9 |
| Molecular Weight | 501.97 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | (2S,4S,5S)-2-[2-chloro-5-[3'-(trideuteriomethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [2H]C([2H])([2H])OC1(c2ccc(Cl)c(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C24H31ClO9/c1-30-24(23(33-34-24)14-5-11-4-12(7-14)8-15(23)6-11)13-2-3-16(25)17(9-13)31-22-21(29)20(28)19(27)18(10-26)32-22/h2-3,9,11-12,14-15,18-22,26-29H,4-8,10H2,1H3/t11?,12?,14?,15?,18?,19-,20+,21?,22-,23?,24?/m1/s1/i1D3 |
| InChIKey | WHIDQNIBLUYEHX-LAORDNGQSA-N |
| XLogP | 1.47 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.97 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|