C20H23ClF3O7P — CID 134409792
[3-[1-chloro-3'-(2,2,2-trifluoroethoxy)spiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] methyl hydrogen phosphate (PubChem CID 134409792) has the molecular formula C20H23ClF3O7P and a molecular weight of 498.82 g/mol. Its IUPAC name is [3-[1-chloro-3'-(2,2,2-trifluoroethoxy)spiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] methyl hydrogen phosphate.
| Compound Name | [3-[1-chloro-3'-(2,2,2-trifluoroethoxy)spiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] methyl hydrogen phosphate |
|---|---|
| PubChem CID | 134409792 |
| Molecular Formula | C20H23ClF3O7P |
| Molecular Weight | 498.82 g/mol |
| Exact Mass | 498.08 |
| IUPAC Name | [3-[1-chloro-3'-(2,2,2-trifluoroethoxy)spiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] methyl hydrogen phosphate |
| SMILES | COP(=O)(O)Oc1cccc(C2(OCC(F)(F)F)OOC23C2CC4CC3CC(Cl)(C4)C2)c1 |
| InChI | InChI=1S/C20H23ClF3O7P/c1-27-32(25,26)29-16-4-2-3-13(7-16)20(28-11-18(22,23)24)19(30-31-20)14-5-12-6-15(19)10-17(21,8-12)9-14/h2-4,7,12,14-15H,5-6,8-11H2,1H3,(H,25,26) |
| InChIKey | PJZNQDCUPPMQFR-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.82 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|