C19H22F3O7P — CID 91195605
[3-[3'-(2,2,2-trifluoroethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] dihydrogen phosphate (PubChem CID 91195605) has the molecular formula C19H22F3O7P and a molecular weight of 450.35 g/mol. Its IUPAC name is [3-[3'-(2,2,2-trifluoroethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] dihydrogen phosphate.
| Compound Name | [3-[3'-(2,2,2-trifluoroethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 91195605 |
| Molecular Formula | C19H22F3O7P |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [3-[3'-(2,2,2-trifluoroethoxy)spiro[adamantane-2,4'-dioxetane]-3'-yl]phenyl] dihydrogen phosphate |
| SMILES | O=P(O)(O)Oc1cccc(C2(OCC(F)(F)F)OOC23C2CC4CC(C2)CC3C4)c1 |
| InChI | InChI=1S/C19H22F3O7P/c20-17(21,22)10-26-19(13-2-1-3-16(9-13)27-30(23,24)25)18(28-29-19)14-5-11-4-12(7-14)8-15(18)6-11/h1-3,9,11-12,14-15H,4-8,10H2,(H2,23,24,25) |
| InChIKey | LRYQCYTUAWTAJI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|