About [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite
[3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite (PubChem CID 89259318) has the molecular formula C18H21IO3
and a molecular weight of 412.27 g/mol. Its IUPAC name is [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite.
Molecular Properties
| Compound Name | [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite |
| PubChem CID | 89259318 |
| Molecular Formula | C18H21IO3 |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite |
| SMILES | CC1(c2cccc(OI)c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C18H21IO3/c1-17(13-3-2-4-16(10-13)20-19)18(22-21-17)14-6-11-5-12(8-14)9-15(18)7-11/h2-4,10-12,14-15H,5-9H2,1H3 |
| InChIKey | IKTZELBAPLIRJR-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite?
The IUPAC name of [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite (CID 89259318) is [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite.
What is the SMILES notation for [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite?
The canonical SMILES for [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite is CC1(c2cccc(OI)c2)OOC12C1CC3CC(C1)CC2C3.
What is the InChIKey of [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite?
The InChIKey is IKTZELBAPLIRJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21IO3/c1-17(13-3-2-4-16(10-13)20-19)18(22-21-17)14-6-11-5-12(8-14)9-15(18)7-11/h2-4,10-12,14-15H,5-9H2,1H3.
What are the key properties of [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite?
[3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite has a molecular weight of 412.27 g/mol, XLogP of 4.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3'-methylspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl] hypoiodite is sourced from PubChem (CID 89259318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).