C25H27NO5 — CID 87693083
4'-methyl-4'-[3-[(4-nitrophenyl)methoxy]phenyl]spiro[adamantane-2,3'-dioxetane] (PubChem CID 87693083) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is 4'-methyl-4'-[3-[(4-nitrophenyl)methoxy]phenyl]spiro[adamantane-2,3'-dioxetane].
| Compound Name | 4'-methyl-4'-[3-[(4-nitrophenyl)methoxy]phenyl]spiro[adamantane-2,3'-dioxetane] |
|---|---|
| PubChem CID | 87693083 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4'-methyl-4'-[3-[(4-nitrophenyl)methoxy]phenyl]spiro[adamantane-2,3'-dioxetane] |
| SMILES | CC1(c2cccc(OCc3ccc([N+](=O)[O-])cc3)c2)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C25H27NO5/c1-24(25(31-30-24)20-10-17-9-18(12-20)13-21(25)11-17)19-3-2-4-23(14-19)29-15-16-5-7-22(8-6-16)26(27)28/h2-8,14,17-18,20-21H,9-13,15H2,1H3 |
| InChIKey | IMYXTMLSZVGINV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|