C21H30N2O4 — CID 155354474
3-[3-[2-(2-aminoethyl)-2-adamantyl]phenoxy]propyl nitrate (PubChem CID 155354474) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-[3-[2-(2-aminoethyl)-2-adamantyl]phenoxy]propyl nitrate.
| Compound Name | 3-[3-[2-(2-aminoethyl)-2-adamantyl]phenoxy]propyl nitrate |
|---|---|
| PubChem CID | 155354474 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 3-[3-[2-(2-aminoethyl)-2-adamantyl]phenoxy]propyl nitrate |
| SMILES | NCCC1(c2cccc(OCCCO[N+](=O)[O-])c2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H30N2O4/c22-6-5-21(18-10-15-9-16(12-18)13-19(21)11-15)17-3-1-4-20(14-17)26-7-2-8-27-23(24)25/h1,3-4,14-16,18-19H,2,5-13,22H2 |
| InChIKey | NGKTVPCROBQMMM-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|