C16H20N2O3 — CID 138666509
[3-(2-amino-2-adamantyl)phenyl] nitrate (PubChem CID 138666509) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is [3-(2-amino-2-adamantyl)phenyl] nitrate.
| Compound Name | [3-(2-amino-2-adamantyl)phenyl] nitrate |
|---|---|
| PubChem CID | 138666509 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | [3-(2-amino-2-adamantyl)phenyl] nitrate |
| SMILES | NC1(c2cccc(O[N+](=O)[O-])c2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C16H20N2O3/c17-16(12-2-1-3-15(9-12)21-18(19)20)13-5-10-4-11(7-13)8-14(16)6-10/h1-3,9-11,13-14H,4-8,17H2 |
| InChIKey | JFZHZAJSIGKXRC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|