C18H19Cl2Na2O7P — CID 10185135
disodium;[2-chloro-5-[(3R)-1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] phosphate (PubChem CID 10185135) has the molecular formula C18H19Cl2Na2O7P and a molecular weight of 495.20 g/mol. Its IUPAC name is disodium;[2-chloro-5-[(3R)-1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] phosphate.
| Compound Name | disodium;[2-chloro-5-[(3R)-1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 10185135 |
| Molecular Formula | C18H19Cl2Na2O7P |
| Molecular Weight | 495.20 g/mol |
| Exact Mass | 494.00 |
| IUPAC Name | disodium;[2-chloro-5-[(3R)-1-chloro-3'-methoxyspiro[adamantane-4,4'-dioxetane]-3'-yl]phenyl] phosphate |
| SMILES | COC1(c2ccc(Cl)c(OP(=O)([O-])[O-])c2)OOC12C1CC3C[C@@H]2CC(Cl)(C3)C1.[Na+].[Na+] |
| InChI | InChI=1S/C18H21Cl2O7P.2Na/c1-24-18(11-2-3-14(19)15(6-11)25-28(21,22)23)17(26-27-18)12-4-10-5-13(17)9-16(20,7-10)8-12;;/h2-3,6,10,12-13H,4-5,7-9H2,1H3,(H2,21,22,23);;/q;2*+1/p-2/t10?,12-,13?,16?,17?,18?;;/m1../s1 |
| InChIKey | NOLGGZQVTAFWLX-KVYPLOKUSA-L |
| XLogP | -3.13 |
| TPSA | 100.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.20 |
| LogP ≤ 5 | -3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|