C19H21Cl2O7P — CID 147951625
[2-chloro-5-(7'-chloro-3-methoxyspiro[dioxetane-4,2'-tetracyclo[5.3.1.03,8.05,9]undecane]-3-yl)phenyl] dihydrogen phosphate (PubChem CID 147951625) has the molecular formula C19H21Cl2O7P and a molecular weight of 463.25 g/mol. Its IUPAC name is [2-chloro-5-(7'-chloro-3-methoxyspiro[dioxetane-4,2'-tetracyclo[5.3.1.03,8.05,9]undecane]-3-yl)phenyl] dihydrogen phosphate.
| Compound Name | [2-chloro-5-(7'-chloro-3-methoxyspiro[dioxetane-4,2'-tetracyclo[5.3.1.03,8.05,9]undecane]-3-yl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 147951625 |
| Molecular Formula | C19H21Cl2O7P |
| Molecular Weight | 463.25 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | [2-chloro-5-(7'-chloro-3-methoxyspiro[dioxetane-4,2'-tetracyclo[5.3.1.03,8.05,9]undecane]-3-yl)phenyl] dihydrogen phosphate |
| SMILES | COC1(c2ccc(Cl)c(OP(=O)(O)O)c2)OOC12C1CC3C4CC2C3C(Cl)(C4)C1 |
| InChI | InChI=1S/C19H21Cl2O7P/c1-25-19(10-2-3-14(20)15(6-10)26-29(22,23)24)18(27-28-19)11-5-12-9-4-13(18)16(12)17(21,7-9)8-11/h2-3,6,9,11-13,16H,4-5,7-8H2,1H3,(H2,22,23,24) |
| InChIKey | INSMOABTGIAZFI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|