C19H22Cl2O5P- — CID 90906088
[2-chloro-5-(1-chloro-3'-methylspiro[adamantane-4,4'-dioxetane]-3'-yl)phenoxy]-methylphosphinate (PubChem CID 90906088) has the molecular formula C19H22Cl2O5P- and a molecular weight of 432.26 g/mol. Its IUPAC name is [2-chloro-5-(1-chloro-3'-methylspiro[adamantane-4,4'-dioxetane]-3'-yl)phenoxy]-methylphosphinate.
| Compound Name | [2-chloro-5-(1-chloro-3'-methylspiro[adamantane-4,4'-dioxetane]-3'-yl)phenoxy]-methylphosphinate |
|---|---|
| PubChem CID | 90906088 |
| Molecular Formula | C19H22Cl2O5P- |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | [2-chloro-5-(1-chloro-3'-methylspiro[adamantane-4,4'-dioxetane]-3'-yl)phenoxy]-methylphosphinate |
| SMILES | CC1(c2ccc(Cl)c(OP(C)(=O)[O-])c2)OOC12C1CC3CC2CC(Cl)(C3)C1 |
| InChI | InChI=1S/C19H23Cl2O5P/c1-17(12-3-4-15(20)16(7-12)24-27(2,22)23)19(26-25-17)13-5-11-6-14(19)10-18(21,8-11)9-13/h3-4,7,11,13-14H,5-6,8-10H2,1-2H3,(H,22,23)/p-1 |
| InChIKey | SESSPOQVYCRDTQ-UHFFFAOYSA-M |
| XLogP | 4.64 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|