C18H21ClO3 — CID 173101126
1-chloro-3'-methoxy-3'-phenylspiro[adamantane-4,4'-dioxetane] (PubChem CID 173101126) has the molecular formula C18H21ClO3 and a molecular weight of 320.82 g/mol. Its IUPAC name is 1-chloro-3'-methoxy-3'-phenylspiro[adamantane-4,4'-dioxetane].
| Compound Name | 1-chloro-3'-methoxy-3'-phenylspiro[adamantane-4,4'-dioxetane] |
|---|---|
| PubChem CID | 173101126 |
| Molecular Formula | C18H21ClO3 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-chloro-3'-methoxy-3'-phenylspiro[adamantane-4,4'-dioxetane] |
| SMILES | COC1(c2ccccc2)OOC12C1CC3CC2CC(Cl)(C3)C1 |
| InChI | InChI=1S/C18H21ClO3/c1-20-18(13-5-3-2-4-6-13)17(21-22-18)14-7-12-8-15(17)11-16(19,9-12)10-14/h2-6,12,14-15H,7-11H2,1H3 |
| InChIKey | ADBRHCFAEPBXDF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|