About 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane]
3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] (PubChem CID 167612934) has the molecular formula C21H26O3
and a molecular weight of 326.44 g/mol. Its IUPAC name is 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane].
Molecular Properties
| Compound Name | 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] |
| PubChem CID | 167612934 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] |
| SMILES | C=Cc1ccc(C2(OC)OOC23C2CC4CC(C2)CC3C4)cc1C |
| InChI | InChI=1S/C21H26O3/c1-4-16-5-6-17(7-13(16)2)21(22-3)20(23-24-21)18-9-14-8-15(11-18)12-19(20)10-14/h4-7,14-15,18-19H,1,8-12H2,2-3H3 |
| InChIKey | SDNMODIBSRXGHD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane]?
The IUPAC name of 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] (CID 167612934) is 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane].
What is the SMILES notation for 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane]?
The canonical SMILES for 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] is C=Cc1ccc(C2(OC)OOC23C2CC4CC(C2)CC3C4)cc1C.
What is the InChIKey of 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane]?
The InChIKey is SDNMODIBSRXGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H26O3/c1-4-16-5-6-17(7-13(16)2)21(22-3)20(23-24-21)18-9-14-8-15(11-18)12-19(20)10-14/h4-7,14-15,18-19H,1,8-12H2,2-3H3.
What are the key properties of 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane]?
3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] has a molecular weight of 326.44 g/mol, XLogP of 4.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(4-ethenyl-3-methylphenyl)-3'-methoxyspiro[adamantane-2,4'-dioxetane] is sourced from PubChem (CID 167612934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).