C21H23ClO6 — CID 146618731
(E)-3-[3-chloro-2-hydroxy-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl]prop-2-enoic acid (PubChem CID 146618731) has the molecular formula C21H23ClO6 and a molecular weight of 406.86 g/mol. Its IUPAC name is (E)-3-[3-chloro-2-hydroxy-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-2-hydroxy-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 146618731 |
| Molecular Formula | C21H23ClO6 |
| Molecular Weight | 406.86 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | (E)-3-[3-chloro-2-hydroxy-4-(3'-methoxyspiro[adamantane-2,4'-dioxetane]-3'-yl)phenyl]prop-2-enoic acid |
| SMILES | COC1(c2ccc(/C=C/C(=O)O)c(O)c2Cl)OOC12C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C21H23ClO6/c1-26-21(16-4-2-13(3-5-17(23)24)19(25)18(16)22)20(27-28-21)14-7-11-6-12(9-14)10-15(20)8-11/h2-5,11-12,14-15,25H,6-10H2,1H3,(H,23,24)/b5-3+ |
| InChIKey | OHVPAQBOGCNLEI-HWKANZROSA-N |
| XLogP | 4.10 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|