C27H36O10 — CID 118424864
4-[3'-[3-(ethoxymethoxy)phenyl]-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxy-2-methoxycarbonylbutanoic acid (PubChem CID 118424864) has the molecular formula C27H36O10 and a molecular weight of 520.58 g/mol. Its IUPAC name is 4-[3'-[3-(ethoxymethoxy)phenyl]-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxy-2-methoxycarbonylbutanoic acid.
| Compound Name | 4-[3'-[3-(ethoxymethoxy)phenyl]-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxy-2-methoxycarbonylbutanoic acid |
|---|---|
| PubChem CID | 118424864 |
| Molecular Formula | C27H36O10 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 4-[3'-[3-(ethoxymethoxy)phenyl]-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxy-2-methoxycarbonylbutanoic acid |
| SMILES | CCOCOc1cccc(C2(OC)OOC23C2CC4CC3CC(OCCC(C(=O)O)C(=O)OC)(C4)C2)c1 |
| InChI | InChI=1S/C27H36O10/c1-4-33-16-34-21-7-5-6-18(12-21)27(32-3)26(36-37-27)19-10-17-11-20(26)15-25(13-17,14-19)35-9-8-22(23(28)29)24(30)31-2/h5-7,12,17,19-20,22H,4,8-11,13-16H2,1-3H3,(H,28,29) |
| InChIKey | KPPZSICLOZWYDT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 118.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|