C25H30Na2O9 — CID 140678470
disodium;2-[2-[3'-(3-ethoxyphenyl)-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxyethyl]propanedioate (PubChem CID 140678470) has the molecular formula C25H30Na2O9 and a molecular weight of 520.49 g/mol. Its IUPAC name is disodium;2-[2-[3'-(3-ethoxyphenyl)-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxyethyl]propanedioate.
| Compound Name | disodium;2-[2-[3'-(3-ethoxyphenyl)-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxyethyl]propanedioate |
|---|---|
| PubChem CID | 140678470 |
| Molecular Formula | C25H30Na2O9 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | disodium;2-[2-[3'-(3-ethoxyphenyl)-3'-methoxyspiro[adamantane-4,4'-dioxetane]-1-yl]oxyethyl]propanedioate |
| SMILES | CCOc1cccc(C2(OC)OOC23C2CC4CC3CC(OCCC(C(=O)[O-])C(=O)[O-])(C4)C2)c1.[Na+].[Na+] |
| InChI | InChI=1S/C25H32O9.2Na/c1-3-31-19-6-4-5-16(11-19)25(30-2)24(33-34-25)17-9-15-10-18(24)14-23(12-15,13-17)32-8-7-20(21(26)27)22(28)29;;/h4-6,11,15,17-18,20H,3,7-10,12-14H2,1-2H3,(H,26,27)(H,28,29);;/q;2*+1/p-2 |
| InChIKey | LPGNQVFAVSYMQH-UHFFFAOYSA-L |
| XLogP | -5.31 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | -5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|