C29H38ClF3O10 — CID 134409793
6-[5-[1-chloro-3-ethyl-7-methyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-4,4'-dioxetane]-3'-yl]-2-ethylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 134409793) has the molecular formula C29H38ClF3O10 and a molecular weight of 639.06 g/mol. Its IUPAC name is 6-[5-[1-chloro-3-ethyl-7-methyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-4,4'-dioxetane]-3'-yl]-2-ethylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[5-[1-chloro-3-ethyl-7-methyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-4,4'-dioxetane]-3'-yl]-2-ethylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 134409793 |
| Molecular Formula | C29H38ClF3O10 |
| Molecular Weight | 639.06 g/mol |
| Exact Mass | 638.21 |
| IUPAC Name | 6-[5-[1-chloro-3-ethyl-7-methyl-3'-(2,2,2-trifluoroethoxy)spiro[bicyclo[3.3.1]nonane-4,4'-dioxetane]-3'-yl]-2-ethylphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | CCc1ccc(C2(OCC(F)(F)F)OOC23C(CC)CC2(Cl)CC(C)CC3C2)cc1OC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C29H38ClF3O10/c1-4-15-6-7-17(9-19(15)40-25-22(36)20(34)21(35)23(41-25)24(37)38)29(39-13-27(31,32)33)28(42-43-29)16(5-2)11-26(30)10-14(3)8-18(28)12-26/h6-7,9,14,16,18,20-23,25,34-36H,4-5,8,10-13H2,1-3H3,(H,37,38) |
| InChIKey | OYYKNNAOKJNSLG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.06 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|