About CID 167499731
CID 167499731 (PubChem CID 167499731) has the molecular formula C19H25BN2O12
and a molecular weight of 484.22 g/mol.
Molecular Properties
| Compound Name | CID 167499731 |
| PubChem CID | 167499731 |
| Molecular Formula | C19H25BN2O12 |
| Molecular Weight | 484.22 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)N(C)CCN(C)C(=O)OCc1ccc(O)cc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H25BN2O12/c1-21(5-6-22(2)19(30)34-20)18(29)31-8-9-3-4-10(23)7-11(9)32-17-14(26)12(24)13(25)15(33-17)16(27)28/h3-4,7,12-15,17,23-26H,5-6,8H2,1-2H3,(H,27,28)/t12-,13-,14+,15-,17+/m0/s1 |
| InChIKey | CMHPQCJVMUITBF-KSXIZUIISA-N |
| XLogP | -1.62 |
| TPSA | 195.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 167499731 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 167499731?
The IUPAC name of CID 167499731 (CID 167499731) is not available.
What is the SMILES notation for CID 167499731?
The canonical SMILES for CID 167499731 is [B]OC(=O)N(C)CCN(C)C(=O)OCc1ccc(O)cc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O.
What is the InChIKey of CID 167499731?
The InChIKey is CMHPQCJVMUITBF-KSXIZUIISA-N. The full InChI is InChI=1S/C19H25BN2O12/c1-21(5-6-22(2)19(30)34-20)18(29)31-8-9-3-4-10(23)7-11(9)32-17-14(26)12(24)13(25)15(33-17)16(27)28/h3-4,7,12-15,17,23-26H,5-6,8H2,1-2H3,(H,27,28)/t12-,13-,14+,15-,17+/m0/s1.
What are the key properties of CID 167499731?
CID 167499731 has a molecular weight of 484.22 g/mol, XLogP of -1.62, 8 rotatable bonds, 5 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 167499731 is sourced from PubChem (CID 167499731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).