C19H25BN2O12 — CID 167499731
CID 167499731 (PubChem CID 167499731) has the molecular formula C19H25BN2O12 and a molecular weight of 484.22 g/mol.
| Compound Name | CID 167499731 |
|---|---|
| PubChem CID | 167499731 |
| Molecular Formula | C19H25BN2O12 |
| Molecular Weight | 484.22 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | — |
| SMILES | [B]OC(=O)N(C)CCN(C)C(=O)OCc1ccc(O)cc1O[C@@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C19H25BN2O12/c1-21(5-6-22(2)19(30)34-20)18(29)31-8-9-3-4-10(23)7-11(9)32-17-14(26)12(24)13(25)15(33-17)16(27)28/h3-4,7,12-15,17,23-26H,5-6,8H2,1-2H3,(H,27,28)/t12-,13-,14+,15-,17+/m0/s1 |
| InChIKey | CMHPQCJVMUITBF-KSXIZUIISA-N |
| XLogP | -1.62 |
| TPSA | 195.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|