C33H39ClO8 — CID 153174822
1-[4-[[3-[2-adamantylidene(methoxy)methyl]-4-chloro-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]phenyl]ethanone (PubChem CID 153174822) has the molecular formula C33H39ClO8 and a molecular weight of 599.12 g/mol. Its IUPAC name is 1-[4-[[3-[2-adamantylidene(methoxy)methyl]-4-chloro-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]phenyl]ethanone.
| Compound Name | 1-[4-[[3-[2-adamantylidene(methoxy)methyl]-4-chloro-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 153174822 |
| Molecular Formula | C33H39ClO8 |
| Molecular Weight | 599.12 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 1-[4-[[3-[2-adamantylidene(methoxy)methyl]-4-chloro-5-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl]phenyl]ethanone |
| SMILES | COC(=C1C2CC3CC(C2)CC1C3)c1cc(Cc2ccc(C(C)=O)cc2)cc(O[C@@H]2OC(CO)[C@H](O)[C@H](O)C2O)c1Cl |
| InChI | InChI=1S/C33H39ClO8/c1-16(36)21-5-3-17(4-6-21)7-20-13-24(32(40-2)27-22-9-18-8-19(11-22)12-23(27)10-18)28(34)25(14-20)41-33-31(39)30(38)29(37)26(15-35)42-33/h3-6,13-14,18-19,22-23,26,29-31,33,35,37-39H,7-12,15H2,1-2H3/b32-27-/t18?,19?,22?,23?,26?,29-,30-,31?,33+/m0/s1 |
| InChIKey | WEYNGLGTAALLND-NOEUUDBOSA-N |
| XLogP | 4.13 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.12 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|