C34H37ClO11 — CID 177323880
(E)-3-[3-chloro-4-[methoxy-(6-oxo-2-adamantylidene)methyl]-2-[[4-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoic acid (PubChem CID 177323880) has the molecular formula C34H37ClO11 and a molecular weight of 657.11 g/mol. Its IUPAC name is (E)-3-[3-chloro-4-[methoxy-(6-oxo-2-adamantylidene)methyl]-2-[[4-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-4-[methoxy-(6-oxo-2-adamantylidene)methyl]-2-[[4-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177323880 |
| Molecular Formula | C34H37ClO11 |
| Molecular Weight | 657.11 g/mol |
| Exact Mass | 656.20 |
| IUPAC Name | (E)-3-[3-chloro-4-[methoxy-(6-oxo-2-adamantylidene)methyl]-2-[[4-[(2S,4S,5R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methoxy]phenyl]prop-2-enoic acid |
| SMILES | COC(=C1C2CC3CC1CC(C2)C3=O)c1ccc(/C=C/C(=O)O)c(OCc2ccc(O[C@@H]3OC(CO)[C@H](O)[C@H](O)C3O)cc2)c1Cl |
| InChI | InChI=1S/C34H37ClO11/c1-43-33(26-18-10-20-12-19(26)13-21(11-18)28(20)39)23-8-4-17(5-9-25(37)38)32(27(23)35)44-15-16-2-6-22(7-3-16)45-34-31(42)30(41)29(40)24(14-36)46-34/h2-9,18-21,24,29-31,34,36,40-42H,10-15H2,1H3,(H,37,38)/b9-5+,33-26-/t18?,19?,20?,21?,24?,29-,30-,31?,34+/m0/s1 |
| InChIKey | PLPLKNFTZNRBHR-HOYUTKEYSA-N |
| XLogP | 3.19 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.11 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|